Geological Literature
Crystal structure of Fe-bearing hydrous forsterite and its possible hydrogen positions(K131-016)(abs.)
KUDOH Yasuhiro, KURIBAYASHI Takahiro, LITASOV Konstantin, OHTANI Eiji
| item | description |
|---|---|
| Title | Crystal structure of Fe-bearing hydrous forsterite and its possible hydrogen positions(K131-016)(abs.) |
| Authors | KUDOH Yasuhiro, KURIBAYASHI Takahiro, LITASOV Konstantin, OHTANI Eiji |
| Data name | Abstracts, Japan Geoscience Union Meeting (CD-ROM) |
| Volume | 2007 |
| Page | K131-016 |
| Year | 2007 |
| Publisher | Japan Geoscience Union |
| Language | JA, EN |
| @id | https://gbank.gsj.jp/ld/resource/geolis/200731927 |